| 3-Ethoxypropionitrile Basic information |
| Product Name: | 3-Ethoxypropionitrile |
| Synonyms: | propanenitrile,3-ethoxy-;Propionitrile, 3-ethoxy-;beta-aethoxypropionitril;beta-Ethoxypropionitrile;Propanenitrile, 3-ethoxy-;2-Cyanoethyl ethyl ether;2-Cyanoethylethyl ether;propionitrile,3-ethoxy- |
| CAS: | 2141-62-0 |
| MF: | C5H9NO |
| MW: | 99.13 |
| EINECS: | 218-393-4 |
| Product Categories: | |
| Mol File: | 2141-62-0.mol |
| 3-Ethoxypropionitrile Chemical Properties |
| Melting point | 48.9 °C |
| Boiling point | 171°C |
| density | 0.894 |
| refractive index | 1.4075 |
| Fp | 64°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 741924 |
| CAS DataBase Reference | 2141-62-0(CAS DataBase Reference) |
| NIST Chemistry Reference | C2H5CH(OC2H5)CH2CN(2141-62-0) |
| EPA Substance Registry System | Propanenitrile, 3-ethoxy- (2141-62-0) |
| Safety Information |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36-37 |
| RIDADR | 3276 |
| RTECS | TZ4680000 |
| TSCA | Yes |
| HS Code | 29269090 |
| MSDS Information |
| Provider | Language |
|---|---|
| ALFA | English |
| 3-Ethoxypropionitrile Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| 3-Ethoxypropionitrile Preparation Products And Raw materials |
| Raw materials | Bromoethane |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.
日本语
한국어
Français
Deutsch
España
Türkiye