Other grades of this product :
| Indisulam Basic information |
| Product Name: | Indisulam | | Synonyms: | INDISULAM;1,4-Benzenedisulfonamide, N-(3-chloro-1H-indol-7-yl)-;N-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide;E-7070;ER-35744;IndisulaM (E7070);IndisulaM (E7070) (ER-35744);N1-(3-Chloro-1H-indol-7-yl)benzene-1,4-disulfonamide | | CAS: | 165668-41-7 | | MF: | C14H12ClN3O4S2 | | MW: | 385.85 | | EINECS: | | Product Categories: | | Mol File: | 165668-41-7.mol |
| Indisulam Chemical Properties |
| Melting point | 242-243 °C (decomp)(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 668.9±65.0 °C(Predicted) | | density | 1.663±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 8.14±0.30(Predicted) | | color | white to beige |
| Indisulam Usage And Synthesis |
| Biochem/physiol Actions | Indisulam is a carbonic anhydrase inibitor and Antitumor CDK inhibitor. Indisulam targets the G1 phase of the cell cycle by depleting cyclin E. inducing p53 and p21, and inhibiting CDK2, causing a blockade in the G1/S transition. |
| Indisulam Preparation Products And Raw materials |
|