| Benzothiazole, 2-methoxy- (7CI,9CI) Basic information |
| Product Name: | Benzothiazole, 2-methoxy- (7CI,9CI) |
| Synonyms: | Benzothiazole, 2-methoxy- (7CI,9CI);2-Methoxy-1,3-benzothiazole;Benzothiazole, 2-methoxy-;Inchi=1/C8H7nos/C1-10-8-9-6-4-2-3-5-7(6)11-8/H2-5H,1h;2-Methoxybenzothiazole 97% |
| CAS: | 63321-86-8 |
| MF: | C8H7NOS |
| MW: | 165.21 |
| EINECS: | |
| Product Categories: | BENZOTHIAZOLE |
| Mol File: | 63321-86-8.mol |
| Benzothiazole, 2-methoxy- (7CI,9CI) Chemical Properties |
| Melting point | 34-38°C |
| Boiling point | 119 °C(Press: 30 Torr) |
| density | 1.268±0.06 g/cm3(Predicted) |
| Fp | 110℃ |
| pka | 2.11±0.10(Predicted) |
| Safety Information |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| MSDS Information |
| Benzothiazole, 2-methoxy- (7CI,9CI) Usage And Synthesis |
| Benzothiazole, 2-methoxy- (7CI,9CI) Preparation Products And Raw materials |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.