Other grades of this product :
| 2,2'-DINITRO-4,4'-DICHLORO DIPHENYL DISUFIDE Basic information |
| Product Name: | 2,2'-DINITRO-4,4'-DICHLORO DIPHENYL DISUFIDE | | Synonyms: | 2,2''-DINITRO-4,4''-DICHLORODIPHENYL DISUFIDE 98%;1,1'-Dithiobis(4-chloro-2-nitrobenzene);Bis(2-nitro-4-chlorophenyl) persulfide;Bis(4-chloro-2-nitrophenyl) persulfide;4,4’-Dichloro-2,2'-dinitro diphenyl;4-chloro-2-nitrophenyl disulfide;4-chloro-1-(4-chloro-2-nitro-phenyl)disulfanyl-2-nitro-benzene;4-chloro-1-(4-chloro-2-nitrophenyl)disulfanyl-2-nitrobenzene | | CAS: | 2050-66-0 | | MF: | C12H6Cl2N2O4S2 | | MW: | 377.22 | | EINECS: | 218-094-9 | | Product Categories: | | Mol File: | 2050-66-0.mol |
| 2,2'-DINITRO-4,4'-DICHLORO DIPHENYL DISUFIDE Chemical Properties |
| 2,2'-DINITRO-4,4'-DICHLORO DIPHENYL DISUFIDE Usage And Synthesis |
| Uses | Bis(4-Chloro-2-nitrophenyl) Disulfide, is a building block used in various chemical synthesis such as in the preparation of novel benzothiazine derivatives. |
| 2,2'-DINITRO-4,4'-DICHLORO DIPHENYL DISUFIDE Preparation Products And Raw materials |
|