Other grades of this product :
| AKOS BRN-1183 Basic information |
| Product Name: | AKOS BRN-1183 | | Synonyms: | AKOS BRN-1183;(2-Bromo-6-chlorophenyl);Boronic acid, B-(2-bromo-6-chlorophenyl)- | | CAS: | 1107580-65-3 | | MF: | C6H5BBrClO2 | | MW: | 235.27 | | EINECS: | | Product Categories: | | Mol File: | 1107580-65-3.mol |
| AKOS BRN-1183 Chemical Properties |
| Boiling point | 360.8±52.0 °C(Predicted) | | density | 1.79±0.1 g/cm3(Predicted) | | pka | 7.96±0.58(Predicted) |
| HazardClass | IRRITANT | | HS Code | 2931900090 |
| AKOS BRN-1183 Usage And Synthesis |
| AKOS BRN-1183 Preparation Products And Raw materials |
|