| 5-Chloro-2-pentanone Basic information |
| Product Name: | 5-Chloro-2-pentanone |
| Synonyms: | 5-Chloro-2-pentanone, 90% 100GR;5-Chloro-2-pentanone,90%;Hydroxychloroquine sulfate Impurity 2;5-chloro -2-ketone;Chloro-2-pentan;1-Chloro-4-oxopentane, 3-Chloroprop-1-yl methyl ketone;oro-2-pentanone;5-Chloro-2-pentanone,97% |
| CAS: | 5891-21-4 |
| MF: | C5H9ClO |
| MW: | 120.58 |
| EINECS: | 227-565-8 |
| Product Categories: | Antiparasitic Agents;API Intermediate;ACETYLGROUP;Miscellaneous |
| Mol File: | 5891-21-4.mol |
| 5-Chloro-2-pentanone Chemical Properties |
| Boiling point | 71-72 °C/20 mmHg (lit.) |
| density | 1.057 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 96 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in chloroform and methanol. |
| form | Liquid |
| color | Brown to black |
| Specific Gravity | 1.057 |
| BRN | 1098490 |
| InChI | InChI=1S/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3 |
| InChIKey | XVRIEWDDMODMGA-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCCl |
| CAS DataBase Reference | 5891-21-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pentanone, 5-chloro-(5891-21-4) |
| EPA Substance Registry System | 2-Pentanone, 5-chloro- (5891-21-4) |
| Safety Information |
| Hazard Codes | Xn,F |
| Risk Statements | 36/37/38-22-10 |
| Safety Statements | 23-24/25-37/39-26-16 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| RTECS | SA8143500 |
| F | 8-10 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29147090 |
| MSDS Information |
| Provider | Language |
|---|---|
| 5-Chloropentan-2-one | English |
| ACROS | English |
| SigmaAldrich | English |
| ALFA | English |
| 5-Chloro-2-pentanone Usage And Synthesis |
| Chemical Properties | Brown to black liquid |
| Uses | 5-Chloro-2-pentanone used in the preparation of destructible surfactants. |
| 5-Chloro-2-pentanone Preparation Products And Raw materials |
| Preparation Products | 5-[ethyl(2-hydroxyethyl)amino]pentan-2-one-->2-(3-CHLOROPROPYL)-2,5,5-TRIMETHYL-[1,3]-DIOXANE-->DEPMPO-->2-Methyl-1-pyrroline |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.
日本语
한국어
Français
Deutsch
España
Türkiye