| 2-FLUOROTHIOPHENOL Basic information |
| Product Name: | 2-FLUOROTHIOPHENOL |
| Synonyms: | 2-Fluorothiophenol 2-Mercaptofluorobenzene;Fluorothiophenol;o-Fluoro Thiophenol;o-fluorothiophenol;2-Fluoromercaptobenzene;2-Fluorothiophenol 98%;2-Fluorothiophenol98%;1-Fluoro-2-mercaptobenzene |
| CAS: | 2557-78-0 |
| MF: | C6H5FS |
| MW: | 128.17 |
| EINECS: | 202-710-8 |
| Product Categories: | Fluorine series;Other Fluorinated Organic Building Blocks;Aryl Fluorinated Building Blocks;Building Blocks;Sulfur Compounds;Thiols/Mercaptans;Phenol&Thiophenol&Mercaptan;Fluorobenzene;Miscellaneous;C6;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks |
| Mol File: | 2557-78-0.mol |
| 2-FLUOROTHIOPHENOL Chemical Properties |
| Boiling point | 61-62 °C/35 mmHg (lit.) |
| density | 1.2 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 118 °F |
| storage temp. | 2-8°C |
| pka | 6.00±0.43(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.20 |
| Sensitive | Stench |
| BRN | 2039768 |
| CAS DataBase Reference | 2557-78-0(CAS DataBase Reference) |
| NIST Chemistry Reference | O-fluorothiophenol(2557-78-0) |
| Safety Information |
| Hazard Codes | Xi,T |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36-36/37/39-27 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Stench |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29309090 |
| MSDS Information |
| Provider | Language |
|---|---|
| SigmaAldrich | English |
| ACROS | English |
| ALFA | English |
| 2-FLUOROTHIOPHENOL Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid |
| Uses | 2-Fluorothiophenol was used in the synthesis of 2-bromo-2′-fluorodiphenyl sulfide. |
| 2-FLUOROTHIOPHENOL Preparation Products And Raw materials |
| Preparation Products | S-HYDROGEN-S-(2-FLUOROPHENYL) SULFOXIMINE-->2-Fluorobenzenesulfonyl chloride |
Please leave a message for us or use the following ways to contact us, we will reply to you as soon as possible, and provide you with the most sincere service, thank you.
日本语
한국어
Français
Deutsch
España
Türkiye