Other grades of this product :
| 1-AMINO-3,3-DIETHOXYPROPANE Basic information |
| Product Name: | 1-AMINO-3,3-DIETHOXYPROPANE | | Synonyms: | 3,3-Diethoxy-1-propanamine;3,3-Diethoxypropylamine;3-AMINOPROPIONALDEHYDE DIETHYL ACETAL;3,3-DIETHOXY-1-PROPYLAMINE;1-AMINO-3,3-DIETHOXYPROPANE;APEA;RARECHEM AL BW 0123;TIMTEC-BB SBB005781 | | CAS: | 41365-75-7 | | MF: | C7H17NO2 | | MW: | 147.22 | | EINECS: | | Product Categories: | | Mol File: | 41365-75-7.mol |
| 1-AMINO-3,3-DIETHOXYPROPANE Chemical Properties |
| Boiling point | 72 °C (12.0016 mmHg) | | density | 0.91 g/mL at 25 °C(lit.) | | refractive index | 1.4233-1.4253 | | Fp | 78 °C | | storage temp. | room temp | | pka | 8.92±0.13(Predicted) | | form | liquid | | color | Clear colorless to yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H17NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-6,8H2,1-2H3 | | InChIKey | PXXMSHBZYAOHBD-UHFFFAOYSA-N | | SMILES | C(N)CC(OCC)OCC | | CAS DataBase Reference | 41365-75-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | I | | HS Code | 29221985 |
| 1-AMINO-3,3-DIETHOXYPROPANE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses | 1-Amino-3,3-diethoxypropane has been used:- with alginate in the preparation of hydrogel
- in the generation of polyethylene glycol (PEG) polyethylenimine (PEI) polyplexes conjugate for transfection studies in hepatocellular carcinoma cell cultures
- as a component of pH-sensitive PEG derivative for lipopolyplexes formation
| | General Description | 1-Amino-3,3-diethoxypropane is an effective modulator of alginate and chitosan based hydrogels and effectively used for the delivery of bone marrow stromal cells (BMSCs) for regeneration of cartilage. |
| 1-AMINO-3,3-DIETHOXYPROPANE Preparation Products And Raw materials |
|
日本语
한국어
Français
Deutsch
España
Türkiye