Other grades of this product :
| 1-Butylpyrrolidin-2-one Basic information |
| 1-Butylpyrrolidin-2-one Chemical Properties |
| Boiling point | 137 °C / 28mmHg | | density | 0,96 g/cm3 | | vapor pressure | 13Pa at 25℃ | | refractive index | 1.4640 to 1.4660 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly) | | form | Oil | | pka | -0.41±0.20(Predicted) | | color | Colourless | | Water Solubility | 1000g/L at 20℃ | | InChI | InChI=1S/C8H15NO/c1-2-3-6-9-7-4-5-8(9)10/h2-7H2,1H3 | | InChIKey | BNXZHVUCNYMNOS-UHFFFAOYSA-N | | SMILES | N1(CCCC)CCCC1=O | | LogP | 1.265 at 20℃ | | CAS DataBase Reference | 3470-98-2(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Pyrrolidinone, 1-butyl-(3470-98-2) | | EPA Substance Registry System | 2-Pyrrolidinone, 1-butyl- (3470-98-2) |
| Safety Statements | 23-24/25 | | RTECS | UY5746000 | | HS Code | 2933790030 |
| 1-Butylpyrrolidin-2-one Usage And Synthesis |
| Chemical Properties | corlorless clear liquid | | Flammability and Explosibility | Notclassified |
| 1-Butylpyrrolidin-2-one Preparation Products And Raw materials |
|