Other grades of this product :
| tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate Basic information |
| Product Name: | tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate | | Synonyms: | tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate;6-oxo-2-azaspiro[3.3]heptane-2-carboxylate;2-Boc-6-hydroxy-2-aza-spi...;2-Boc-6-hydroxy-2-aza-spiro[3.3]heptane;6-Hydroxy-2-azaspiro[3.3]heptane-2-carboxylic acid tert-butyl ester;2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-hydroxy-, 1,1-diMethylethyl ester;6-Hydroxy-2-azaspiro[3.3]heptane, N-BOC protected;tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate, 2-(tert-Butoxycarbonyl)-6-hydroxy-2-azaspiro[3.3]heptane | | CAS: | 1147557-97-8 | | MF: | C11H19NO3 | | MW: | 213.27 | | EINECS: | | Product Categories: | | Mol File: | 1147557-97-8.mol |
| tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate Chemical Properties |
| Melting point | 127-129℃ | | Boiling point | 316.6±42.0 °C(Predicted) | | density | 1.17 | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 14.84±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H19NO3/c1-10(2,3)15-9(14)12-6-11(7-12)4-8(13)5-11/h8,13H,4-7H2,1-3H3 | | InChIKey | UMXXHZDEAZUQKZ-UHFFFAOYSA-N | | SMILES | C1C2(CC(O)C2)CN1C(OC(C)(C)C)=O |
| tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate Usage And Synthesis |
| Uses | tert-?Butyl 6-?Hydroxy-?2-?azaspiro[3.3]?heptane-?2-?carboxylate is a reactant used in the synthesis of pharmaceuticals such as CNS penetrant CXCR2 antagonists for the potential treatment of CNS demyelinating. |
| tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate Preparation Products And Raw materials |
|