Other grades of this product :
| N-(N-PROPYL)ACETAMIDE Basic information |
| Product Name: | N-(N-PROPYL)ACETAMIDE | | Synonyms: | N-(N-PROPYL)ACETAMIDE;Acetamide, N-n-propyl-,;Acetamide, N-propyl-;N-Propylacetamide;N-(n-Propyl)acetamide,98%;Inchi=1/C5H11no/C1-3-4-6-5(2)7/H3-4H2,1-2H3,(H,6,7;N-(N-PROPYL)ACETAMIDE ISO 9001:2015 REACH;acetyl propyl amine | | CAS: | 5331-48-6 | | MF: | C5H11NO | | MW: | 101.15 | | EINECS: | 226-231-9 | | Product Categories: | | Mol File: | 5331-48-6.mol |
| N-(N-PROPYL)ACETAMIDE Chemical Properties |
| density | 0,912 g/cm3 | | refractive index | 1.4370 | | BRN | 1699600 | | CAS DataBase Reference | 5331-48-6 |
| Provider | Language |
|
ALFA
| English |
| N-(N-PROPYL)ACETAMIDE Usage And Synthesis |
| N-(N-PROPYL)ACETAMIDE Preparation Products And Raw materials |
|